[Soda ash knowledge] Daily question (11) 2009.10.14
Thread Content
Please hide the reply. If you do not hide it, you will not be graded in principle. Specific hiding methods: http://bbs.hcbbs.com/viewthread.php?tid=492556&highlight=%D2%FE%B2%D8 Edited posts are not graded. (The title of this issue is taken from page 61 of "Technical Worker Job Training Question Bank - Soda Ash Production Operator". The electronic version of the book is available for download in the soda ash information sharing area. http://bbs.hcbbs.com/thread-13140-1-2.html ) Short answer question: Write the chemical reaction formula of mother liquor absorbing ammonia and carbon dioxide.
The reaction of mother liquor absorbing ammonia and carbon dioxide is as follows: ① Ammonia gas dissolves in water to form ammonium hydroxide: 3+ H2O→4OH ② The carbon dioxide in the distilled ammonia dissolves in water to form carbonic acid, then dissolves with the mother liquor in water to form carbonic acid, and then reacts with the ammonium hydroxide in the mother liquor to form ammonium carbonate: 2 + H 20 →H ns = "urn:schemas-microsoft-com:office:smarttags" />2C03 H 2C03 + 2NH 4OH→ (4) 22 + 2H 20 ③ The bicarbonate in the mother liquor neutralizes with the hydroxide to generate carbonate: 4OH Na2C03＋（4）22十2H 20"urn:schemas-microsoft-com:office:office" />
1. Ammonia gas dissolves in water to generate ammonium hydroxide NH3+H2O=NH4OH 2. Carbon dioxide dissolves in water to generate carbonic acid, which then reacts with the ammonium hydroxide in the mother liquor to generate ammonium carbonate CO2+H20=H2CO3 NH4OH+2H2CO3=(NH4)2CO3+2H20 3. The bicarbonate and ammonium hydroxide in the mother liquor are neutralized to generate carbonate 2NaHCO3+2NH4OH=Na2CO3+(NH4)2CO3+2H2O NH4HCO3+NH4OH=(NH4)2CO3+H2O
NaCl+NH3CO2+H2O→NaHCO3+NH4Cl 2NaHCO3→Na2CO3+CO2+H2O
1. Ammonia gas dissolves in water to form ammonium hydroxide: NH3+H2O→NH4OH 2. The carbon dioxide in the distilled ammonia dissolves in water to form carbonic acid, then dissolves with the mother liquor in water to form carbonic acid, and then reacts with the ammonium hydroxide in the mother liquor to form ammonium carbonate.: CO2+H2O→H2CO3 H2CO3+2NH4OH→(NH4)2CO3+2H2O 3. The bicarbonate in the mother liquor is neutralized with sodium hydroxide to form carbonate: 2NaHCO3+2NH4OH→Na2CO3+(NH4)2CO3+2H2O
1. Ammonia gas dissolves in water to generate ammonium hydroxide NH3+H2O=NH4OH 2. Carbon dioxide dissolves in water to generate carbonic acid, which then reacts with the ammonium hydroxide in the mother liquor to generate ammonium carbonate CO2+H20=H2CO3 NH4OH+2H2CO3=(NH4)2CO3+2H20 3. The bicarbonate and ammonium hydroxide in the mother liquor are neutralized to generate carbonate 2NaHCO3+2NH4OH=Na2CO3+(NH4)2CO3+2H2O NH4HCO3+NH4OH=(NH4)2CO3+H2O
NH3(g)+H2O(l)→NH4OH(aq)+34748J/mol; CO2(g)+H2O(l)→H2CO3(aq)+20152J/mol; 2NH4OH(aq)+H2CO3(aq)→(NH4)2CO3(aq)+2H2O(l)+73836J/mol; H2S(g)→H2S(aq); 2NH4OH(aq)+H2S(g)→(NH4)2S(aq)+2H2O(l).
Write the chemical reaction formula of the mother liquor absorbing ammonia and carbon dioxide 1. Ammonia dissolves in water to form ammonium hydroxide NH3+H2O→NH4OH 2. The carbon dioxide in the distilled ammonia dissolves in water to form carbonic acid, which then dissolves with the mother liquor in water to form carbonic acid, and then reacts with the ammonium hydroxide in the mother liquor to form ammonium carbonate CO2+H2O→H2CO3 H2CO3+2NH4OH→(NH4)2CO3+2H2O 3. The bicarbonate in the mother liquor is neutralized with ammonium hydroxide to generate carbonate 2NaHCO3+2NH4OH→Na2CO3+(NH4)2CO3+2H2O
NaCl+H2O+NH3+CO2→NaHCO3+NH4Cl
The reaction of the mother liquor absorbing ammonia and carbon dioxide is as follows ① Ammonia dissolves in water to generate ammonium hydroxide: NH3+H2O→NH4OH ② The carbon dioxide in the distilled ammonia dissolves in water to generate carbonic acid, which is then dissolved in water to generate carbonic acid, and then reacts with the ammonium hydroxide in the mother liquor to generate ammonium carbonate CO2+H2O→H2CO3 H2CO3+2NH4OH→(NH4)2CO3 +2H20 ③The bicarbonate in the mother liquor is neutralized with ammonium hydroxide to generate carbonate: 2NaHCO3+2NH4OH→Na2CO3+(NH4)CO3 +2H20 NH4HCO3+NH4OH→(NH4)2CO3+2H2O
NaCl+NH3+H2O+COO2--->NH4Cl+NaHCO3 2NaHCO3---->Na2CO3+CO2+H2O